C9H13BrO3 — CID 24894261
(3aR,5R,6S,7aR)-6-bromo-5-ethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one (PubChem CID 24894261) has the molecular formula C9H13BrO3 and a molecular weight of 249.10 g/mol. Its IUPAC name is (3aR,5R,6S,7aR)-6-bromo-5-ethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3aR,5R,6S,7aR)-6-bromo-5-ethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 24894261 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | (3aR,5R,6S,7aR)-6-bromo-5-ethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
| SMILES | CC[C@H]1O[C@@H]2CC(=O)O[C@@H]2C[C@@H]1Br |
| InChI | InChI=1S/C9H13BrO3/c1-2-6-5(10)3-7-8(12-6)4-9(11)13-7/h5-8H,2-4H2,1H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | GSSYDUUSZQVYRE-LXGUWJNJSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|