C22H22ClN3O3S — CID 24894344
4-[5-(4-chlorophenyl)-2-methyl-3-(pyrrolidine-1-carbonyl)pyrrol-1-yl]benzenesulfonamide (PubChem CID 24894344) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-2-methyl-3-(pyrrolidine-1-carbonyl)pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-(4-chlorophenyl)-2-methyl-3-(pyrrolidine-1-carbonyl)pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24894344 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-2-methyl-3-(pyrrolidine-1-carbonyl)pyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1c(C(=O)N2CCCC2)cc(-c2ccc(Cl)cc2)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22ClN3O3S/c1-15-20(22(27)25-12-2-3-13-25)14-21(16-4-6-17(23)7-5-16)26(15)18-8-10-19(11-9-18)30(24,28)29/h4-11,14H,2-3,12-13H2,1H3,(H2,24,28,29) |
| InChIKey | TZWOXZDMIVGYTP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|