C18H18N4O3 — CID 24894404
(2S)-2-amino-3-[4-[5-(furan-3-ylmethylamino)pyrazin-2-yl]phenyl]propanoic acid (PubChem CID 24894404) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[5-(furan-3-ylmethylamino)pyrazin-2-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[5-(furan-3-ylmethylamino)pyrazin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24894404 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2S)-2-amino-3-[4-[5-(furan-3-ylmethylamino)pyrazin-2-yl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(-c2cnc(NCc3ccoc3)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C18H18N4O3/c19-15(18(23)24)7-12-1-3-14(4-2-12)16-9-22-17(10-20-16)21-8-13-5-6-25-11-13/h1-6,9-11,15H,7-8,19H2,(H,21,22)(H,23,24)/t15-/m0/s1 |
| InChIKey | HYQZBTQOPVVOQX-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |