C16H20O6 — CID 24894479
bis(prop-2-enyl) 1,4-dimethyl-2,5-dioxocyclohexane-1,4-dicarboxylate (PubChem CID 24894479) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is bis(prop-2-enyl) 1,4-dimethyl-2,5-dioxocyclohexane-1,4-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 1,4-dimethyl-2,5-dioxocyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 24894479 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | bis(prop-2-enyl) 1,4-dimethyl-2,5-dioxocyclohexane-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)C1(C)CC(=O)C(C)(C(=O)OCC=C)CC1=O |
| InChI | InChI=1S/C16H20O6/c1-5-7-21-13(19)15(3)9-12(18)16(4,10-11(15)17)14(20)22-8-6-2/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | IPXNHRLVOVOGBH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|