C18H18F3N3O4S — CID 24894570
1-(3-morpholin-4-ylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 24894570) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-morpholin-4-ylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 24894570 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-(3-morpholin-4-ylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H18F3N3O4S/c19-18(20,21)13-4-6-14(7-5-13)22-17(25)23-15-2-1-3-16(12-15)29(26,27)24-8-10-28-11-9-24/h1-7,12H,8-11H2,(H2,22,23,25) |
| InChIKey | UWDDTABHGITVJO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |