About (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide
(2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide (PubChem CID 24894624) has the molecular formula C10H16INO
and a molecular weight of 293.15 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide.
Molecular Properties
| Compound Name | (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide |
| PubChem CID | 24894624 |
| Molecular Formula | C10H16INO |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide |
| SMILES | C[N+]1(C)CCC[C@H]1c1ccco1.[I-] |
| InChI | InChI=1S/C10H16NO.HI/c1-11(2)7-3-5-9(11)10-6-4-8-12-10;/h4,6,8-9H,3,5,7H2,1-2H3;1H/q+1;/p-1/t9-;/m0./s1 |
| InChIKey | ISTCTOUZRSAZGU-FVGYRXGTSA-M |
| XLogP | -0.81 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide?
The IUPAC name of (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide (CID 24894624) is (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide.
What is the SMILES notation for (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide?
The canonical SMILES for (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide is C[N+]1(C)CCC[C@H]1c1ccco1.[I-].
What is the InChIKey of (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide?
The InChIKey is ISTCTOUZRSAZGU-FVGYRXGTSA-M. The full InChI is InChI=1S/C10H16NO.HI/c1-11(2)7-3-5-9(11)10-6-4-8-12-10;/h4,6,8-9H,3,5,7H2,1-2H3;1H/q+1;/p-1/t9-;/m0./s1.
What are the key properties of (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide?
(2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide has a molecular weight of 293.15 g/mol, XLogP of -0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(furan-2-yl)-1,1-dimethylpyrrolidin-1-ium iodide is sourced from PubChem (CID 24894624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).