About (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide
(2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide (PubChem CID 24894636) has the molecular formula C11H18INO
and a molecular weight of 307.18 g/mol. Its IUPAC name is (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide.
Molecular Properties
| Compound Name | (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide |
| PubChem CID | 24894636 |
| Molecular Formula | C11H18INO |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide |
| SMILES | Cc1ccc([C@H]2CCC[N+]2(C)C)o1.[I-] |
| InChI | InChI=1S/C11H18NO.HI/c1-9-6-7-11(13-9)10-5-4-8-12(10,2)3;/h6-7,10H,4-5,8H2,1-3H3;1H/q+1;/p-1/t10-;/m1./s1 |
| InChIKey | KYIQLEVPUSNDHE-HNCPQSOCSA-M |
| XLogP | -0.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide?
The IUPAC name of (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide (CID 24894636) is (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide.
What is the SMILES notation for (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide?
The canonical SMILES for (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide is Cc1ccc([C@H]2CCC[N+]2(C)C)o1.[I-].
What is the InChIKey of (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide?
The InChIKey is KYIQLEVPUSNDHE-HNCPQSOCSA-M. The full InChI is InChI=1S/C11H18NO.HI/c1-9-6-7-11(13-9)10-5-4-8-12(10,2)3;/h6-7,10H,4-5,8H2,1-3H3;1H/q+1;/p-1/t10-;/m1./s1.
What are the key properties of (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide?
(2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide has a molecular weight of 307.18 g/mol, XLogP of -0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-1-ium iodide is sourced from PubChem (CID 24894636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).