C13H22O3 — CID 24894749
2-[(3aR,7S,8aS)-2-methoxy-7-methyl-3,3a,4,7,8,8a-hexahydro-2H-cyclohepta[b]furan-6-yl]ethanol (PubChem CID 24894749) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[(3aR,7S,8aS)-2-methoxy-7-methyl-3,3a,4,7,8,8a-hexahydro-2H-cyclohepta[b]furan-6-yl]ethanol.
| Compound Name | 2-[(3aR,7S,8aS)-2-methoxy-7-methyl-3,3a,4,7,8,8a-hexahydro-2H-cyclohepta[b]furan-6-yl]ethanol |
|---|---|
| PubChem CID | 24894749 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-[(3aR,7S,8aS)-2-methoxy-7-methyl-3,3a,4,7,8,8a-hexahydro-2H-cyclohepta[b]furan-6-yl]ethanol |
| SMILES | COC1C[C@H]2CC=C(CCO)[C@@H](C)C[C@@H]2O1 |
| InChI | InChI=1S/C13H22O3/c1-9-7-12-11(8-13(15-2)16-12)4-3-10(9)5-6-14/h3,9,11-14H,4-8H2,1-2H3/t9-,11+,12-,13?/m0/s1 |
| InChIKey | HEENPTIPOGAPAQ-TXECMVRBSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|