C19H22O2Se — CID 24894751
(3S,3aS,7S,8aS)-6-ethenyl-3,7-dimethyl-3-phenylselanyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one (PubChem CID 24894751) has the molecular formula C19H22O2Se and a molecular weight of 361.34 g/mol. Its IUPAC name is (3S,3aS,7S,8aS)-6-ethenyl-3,7-dimethyl-3-phenylselanyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one.
| Compound Name | (3S,3aS,7S,8aS)-6-ethenyl-3,7-dimethyl-3-phenylselanyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 24894751 |
| Molecular Formula | C19H22O2Se |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (3S,3aS,7S,8aS)-6-ethenyl-3,7-dimethyl-3-phenylselanyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
| SMILES | C=CC1=CC[C@H]2[C@H](C[C@@H]1C)OC(=O)[C@@]2(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C19H22O2Se/c1-4-14-10-11-16-17(12-13(14)2)21-18(20)19(16,3)22-15-8-6-5-7-9-15/h4-10,13,16-17H,1,11-12H2,2-3H3/t13-,16-,17-,19-/m0/s1 |
| InChIKey | MITQCHVUUZKRAC-UHEFJODHSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|