C9H12O4 — CID 24894961
methyl (3aR,6aS)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 24894961) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl (3aR,6aS)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | methyl (3aR,6aS)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 24894961 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | methyl (3aR,6aS)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CCC[C@@H]1COC2=O |
| InChI | InChI=1S/C9H12O4/c1-12-7(10)9-4-2-3-6(9)5-13-8(9)11/h6H,2-5H2,1H3/t6-,9-/m1/s1 |
| InChIKey | OUHVEIZLCLAFLM-HZGVNTEJSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|