About 3-imidazol-1-yl-1,1-diphenylpropan-1-ol
3-imidazol-1-yl-1,1-diphenylpropan-1-ol (PubChem CID 24895248) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-imidazol-1-yl-1,1-diphenylpropan-1-ol.
Molecular Properties
| Compound Name | 3-imidazol-1-yl-1,1-diphenylpropan-1-ol |
| PubChem CID | 24895248 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-imidazol-1-yl-1,1-diphenylpropan-1-ol |
| SMILES | OC(CCn1ccnc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c21-18(16-7-3-1-4-8-16,17-9-5-2-6-10-17)11-13-20-14-12-19-15-20/h1-10,12,14-15,21H,11,13H2 |
| InChIKey | SMMCZMNOWZVODM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-imidazol-1-yl-1,1-diphenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-yl-1,1-diphenylpropan-1-ol?
The IUPAC name of 3-imidazol-1-yl-1,1-diphenylpropan-1-ol (CID 24895248) is 3-imidazol-1-yl-1,1-diphenylpropan-1-ol.
What is the SMILES notation for 3-imidazol-1-yl-1,1-diphenylpropan-1-ol?
The canonical SMILES for 3-imidazol-1-yl-1,1-diphenylpropan-1-ol is OC(CCn1ccnc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-imidazol-1-yl-1,1-diphenylpropan-1-ol?
The InChIKey is SMMCZMNOWZVODM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c21-18(16-7-3-1-4-8-16,17-9-5-2-6-10-17)11-13-20-14-12-19-15-20/h1-10,12,14-15,21H,11,13H2.
What are the key properties of 3-imidazol-1-yl-1,1-diphenylpropan-1-ol?
3-imidazol-1-yl-1,1-diphenylpropan-1-ol has a molecular weight of 278.36 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-yl-1,1-diphenylpropan-1-ol is sourced from PubChem (CID 24895248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).