About oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate
oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate (PubChem CID 24895550) has the molecular formula C24H23N3O6S
and a molecular weight of 481.53 g/mol. Its IUPAC name is oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate |
| PubChem CID | 24895550 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2C(=O)c2ccccn2)cc1)OCC1CCCO1 |
| InChI | InChI=1S/C24H23N3O6S/c28-23(22-9-3-4-14-25-22)20-7-1-2-8-21(20)27-34(30,31)19-12-10-17(11-13-19)26-24(29)33-16-18-6-5-15-32-18/h1-4,7-14,18,27H,5-6,15-16H2,(H,26,29) |
| InChIKey | PLUSCNOLGPTWEQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate?
The IUPAC name of oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate (CID 24895550) is oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate.
What is the SMILES notation for oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate?
The canonical SMILES for oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate is O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2C(=O)c2ccccn2)cc1)OCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate?
The InChIKey is PLUSCNOLGPTWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O6S/c28-23(22-9-3-4-14-25-22)20-7-1-2-8-21(20)27-34(30,31)19-12-10-17(11-13-19)26-24(29)33-16-18-6-5-15-32-18/h1-4,7-14,18,27H,5-6,15-16H2,(H,26,29).
What are the key properties of oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate?
oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate has a molecular weight of 481.53 g/mol, XLogP of 3.84, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl N-[4-[[2-(pyridine-2-carbonyl)phenyl]sulfamoyl]phenyl]carbamate is sourced from PubChem (CID 24895550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).