C28H32Cl2FN3O4 — CID 24896084
2-[3-[1-[(2,4-dichloro-5-fluorophenyl)methyl]-3-(3,3-dimethylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]phenyl]acetic acid (PubChem CID 24896084) has the molecular formula C28H32Cl2FN3O4 and a molecular weight of 564.49 g/mol. Its IUPAC name is 2-[3-[1-[(2,4-dichloro-5-fluorophenyl)methyl]-3-(3,3-dimethylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[1-[(2,4-dichloro-5-fluorophenyl)methyl]-3-(3,3-dimethylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24896084 |
| Molecular Formula | C28H32Cl2FN3O4 |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 2-[3-[1-[(2,4-dichloro-5-fluorophenyl)methyl]-3-(3,3-dimethylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]phenyl]acetic acid |
| SMILES | CC(C)(C)CCN1C(=O)N(Cc2cc(F)c(Cl)cc2Cl)C2(CCN(c3cccc(CC(=O)O)c3)CC2)C1=O |
| InChI | InChI=1S/C28H32Cl2FN3O4/c1-27(2,3)7-12-33-25(37)28(34(26(33)38)17-19-15-23(31)22(30)16-21(19)29)8-10-32(11-9-28)20-6-4-5-18(13-20)14-24(35)36/h4-6,13,15-16H,7-12,14,17H2,1-3H3,(H,35,36) |
| InChIKey | HFFFOWBZCUQNAE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|