C24H26F3N5O3S — CID 24896117
5-[2-[N-carbamoyl-4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N,N-dimethylpyridine-2-carboxamide (PubChem CID 24896117) has the molecular formula C24H26F3N5O3S and a molecular weight of 521.57 g/mol. Its IUPAC name is 5-[2-[N-carbamoyl-4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N,N-dimethylpyridine-2-carboxamide.
| Compound Name | 5-[2-[N-carbamoyl-4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N,N-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 24896117 |
| Molecular Formula | C24H26F3N5O3S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 5-[2-[N-carbamoyl-4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N,N-dimethylpyridine-2-carboxamide |
| SMILES | CCCCCOc1ccc(N(C(N)=O)c2nc(-c3ccc(C(=O)N(C)C)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H26F3N5O3S/c1-4-5-6-11-35-20-10-8-16(12-17(20)24(25,26)27)32(22(28)34)23-30-19(14-36-23)15-7-9-18(29-13-15)21(33)31(2)3/h7-10,12-14H,4-6,11H2,1-3H3,(H2,28,34) |
| InChIKey | CUQUDGZALUJTDR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|