About N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide
N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 2489621) has the molecular formula C19H19NO4S
and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide |
| PubChem CID | 2489621 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccco2)Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C19H19NO4S/c1-22-14-7-8-17(18(11-14)23-2)19(21)20(12-15-5-3-9-24-15)13-16-6-4-10-25-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | QHMOUGBWZVEJTR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide?
The IUPAC name of N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide (CID 2489621) is N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide?
The canonical SMILES for N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide is COc1ccc(C(=O)N(Cc2ccco2)Cc2cccs2)c(OC)c1.
What is the InChIKey of N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide?
The InChIKey is QHMOUGBWZVEJTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4S/c1-22-14-7-8-17(18(11-14)23-2)19(21)20(12-15-5-3-9-24-15)13-16-6-4-10-25-16/h3-11H,12-13H2,1-2H3.
What are the key properties of N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide?
N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide has a molecular weight of 357.43 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzamide is sourced from PubChem (CID 2489621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).