C29H35F4N3O3S — CID 24896210
[N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]methyl 2,2-dimethylpropanoate (PubChem CID 24896210) has the molecular formula C29H35F4N3O3S and a molecular weight of 581.68 g/mol. Its IUPAC name is [N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]methyl 2,2-dimethylpropanoate.
| Compound Name | [N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24896210 |
| Molecular Formula | C29H35F4N3O3S |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | [N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCCCOc1ccc(N(COC(=O)C(C)(C)C)c2nc(-c3cccnc3)c(F)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C29H35F4N3O3S/c1-5-6-7-8-9-10-16-38-23-14-13-21(17-22(23)29(31,32)33)36(19-39-26(37)28(2,3)4)27-35-24(25(30)40-27)20-12-11-15-34-18-20/h11-15,17-18H,5-10,16,19H2,1-4H3 |
| InChIKey | QKJAIAXXUOSJQW-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|