C26H33N3O3 — CID 24896237
3-[8-[3-[benzyl-(2-hydroxyacetyl)amino]propyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 24896237) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-[8-[3-[benzyl-(2-hydroxyacetyl)amino]propyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[8-[3-[benzyl-(2-hydroxyacetyl)amino]propyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 24896237 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 3-[8-[3-[benzyl-(2-hydroxyacetyl)amino]propyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(C2CC3CCC(C2)N3CCCN(Cc2ccccc2)C(=O)CO)c1 |
| InChI | InChI=1S/C26H33N3O3/c27-26(32)21-9-4-8-20(14-21)22-15-23-10-11-24(16-22)29(23)13-5-12-28(25(31)18-30)17-19-6-2-1-3-7-19/h1-4,6-9,14,22-24,30H,5,10-13,15-18H2,(H2,27,32) |
| InChIKey | CKXSFVAMUDREIL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |