C30H36F4N4O4S — CID 24896367
tert-butyl N-[2-[N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]-2-oxoethyl]carbamate (PubChem CID 24896367) has the molecular formula C30H36F4N4O4S and a molecular weight of 624.70 g/mol. Its IUPAC name is tert-butyl N-[2-[N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 24896367 |
| Molecular Formula | C30H36F4N4O4S |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | tert-butyl N-[2-[N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-4-octoxy-3-(trifluoromethyl)anilino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCOc1ccc(N(C(=O)CNC(=O)OC(C)(C)C)c2nc(-c3cccnc3)c(F)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H36F4N4O4S/c1-5-6-7-8-9-10-16-41-23-14-13-21(17-22(23)30(32,33)34)38(24(39)19-36-28(40)42-29(2,3)4)27-37-25(26(31)43-27)20-12-11-15-35-18-20/h11-15,17-18H,5-10,16,19H2,1-4H3,(H,36,40) |
| InChIKey | LGCHIRJXRKMYBX-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|