About 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole
1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole (PubChem CID 24896448) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole |
| PubChem CID | 24896448 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole |
| SMILES | Cc1cccc2c1N(Cc1ncc[nH]1)CC2 |
| InChI | InChI=1S/C13H15N3/c1-10-3-2-4-11-5-8-16(13(10)11)9-12-14-6-7-15-12/h2-4,6-7H,5,8-9H2,1H3,(H,14,15) |
| InChIKey | OJBYMYKWHWDLFC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole?
The IUPAC name of 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole (CID 24896448) is 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole.
What is the SMILES notation for 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole?
The canonical SMILES for 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole is Cc1cccc2c1N(Cc1ncc[nH]1)CC2.
What is the InChIKey of 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole?
The InChIKey is OJBYMYKWHWDLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c1-10-3-2-4-11-5-8-16(13(10)11)9-12-14-6-7-15-12/h2-4,6-7H,5,8-9H2,1H3,(H,14,15).
What are the key properties of 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole?
1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole has a molecular weight of 213.28 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-2-ylmethyl)-7-methyl-2,3-dihydroindole is sourced from PubChem (CID 24896448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).