C25H23F3N4O3S — CID 24896542
5-methyl-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 24896542) has the molecular formula C25H23F3N4O3S and a molecular weight of 516.55 g/mol. Its IUPAC name is 5-methyl-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24896542 |
| Molecular Formula | C25H23F3N4O3S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 5-methyl-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCOc1ccc(N(C(=O)c2cc(C)on2)c2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H23F3N4O3S/c1-3-4-5-11-34-22-9-8-18(13-19(22)25(26,27)28)32(23(33)20-12-16(2)35-31-20)24-30-21(15-36-24)17-7-6-10-29-14-17/h6-10,12-15H,3-5,11H2,1-2H3 |
| InChIKey | BLFKCQUQRWBYNH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|