C25H23NO3 — CID 24896581
4-[3-(1-phenylethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol (PubChem CID 24896581) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[3-(1-phenylethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol.
| Compound Name | 4-[3-(1-phenylethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol |
|---|---|
| PubChem CID | 24896581 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[3-(1-phenylethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol |
| SMILES | CC(c1ccccc1)N1COc2cc3c(cc2C1)C=C(c1ccc(O)cc1)CO3 |
| InChI | InChI=1S/C25H23NO3/c1-17(18-5-3-2-4-6-18)26-14-21-11-20-12-22(19-7-9-23(27)10-8-19)15-28-24(20)13-25(21)29-16-26/h2-13,17,27H,14-16H2,1H3 |
| InChIKey | IVXLNHVJWUMNFI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|