C34H46ClN3O — CID 24896636
5-(4-chlorophenyl)-N-[(Z)-octadec-9-enyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 24896636) has the molecular formula C34H46ClN3O and a molecular weight of 548.22 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(Z)-octadec-9-enyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(Z)-octadec-9-enyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24896636 |
| Molecular Formula | C34H46ClN3O |
| Molecular Weight | 548.22 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(Z)-octadec-9-enyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C34H46ClN3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-27-36-34(39)32-28-33(29-23-25-30(35)26-24-29)38(37-32)31-21-18-17-19-22-31/h9-10,17-19,21-26,28H,2-8,11-16,20,27H2,1H3,(H,36,39)/b10-9- |
| InChIKey | IOEQILIYUDHSJY-KTKRTIGZSA-N |
| XLogP | 9.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.22 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|