C22H26ClFN4O4S2 — CID 24897010
S-(3-chloropropyl) 4-[[7-(2-fluoro-4-methylsulfonylphenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidine-1-carbothioate (PubChem CID 24897010) has the molecular formula C22H26ClFN4O4S2 and a molecular weight of 529.06 g/mol. Its IUPAC name is S-(3-chloropropyl) 4-[[7-(2-fluoro-4-methylsulfonylphenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidine-1-carbothioate.
| Compound Name | S-(3-chloropropyl) 4-[[7-(2-fluoro-4-methylsulfonylphenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidine-1-carbothioate |
|---|---|
| PubChem CID | 24897010 |
| Molecular Formula | C22H26ClFN4O4S2 |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | S-(3-chloropropyl) 4-[[7-(2-fluoro-4-methylsulfonylphenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidine-1-carbothioate |
| SMILES | CS(=O)(=O)c1ccc(N2CCc3c(OC4CCN(C(=O)SCCCCl)CC4)ncnc32)c(F)c1 |
| InChI | InChI=1S/C22H26ClFN4O4S2/c1-34(30,31)16-3-4-19(18(24)13-16)28-11-7-17-20(28)25-14-26-21(17)32-15-5-9-27(10-6-15)22(29)33-12-2-8-23/h3-4,13-15H,2,5-12H2,1H3 |
| InChIKey | YQADDSBGHXXZAS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|