C26H21Cl3FN3O — CID 24897233
4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 24897233) has the molecular formula C26H21Cl3FN3O and a molecular weight of 516.83 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24897233 |
| Molecular Formula | C26H21Cl3FN3O |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-2-(1-methylpiperidin-4-yl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | CN1CCC(c2cc(-c3ccc(F)cc3Cl)c3cc[n+]([O-])c(-c4c(Cl)cccc4Cl)c3n2)CC1 |
| InChI | InChI=1S/C26H21Cl3FN3O/c1-32-10-7-15(8-11-32)23-14-19(17-6-5-16(30)13-22(17)29)18-9-12-33(34)26(25(18)31-23)24-20(27)3-2-4-21(24)28/h2-6,9,12-15H,7-8,10-11H2,1H3 |
| InChIKey | GXKYDEUTDIYZST-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|