C28H25Cl3FN3O — CID 24897234
4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-2-(1-propan-2-ylpiperidin-4-yl)-1,7-naphthyridin-7-ium (PubChem CID 24897234) has the molecular formula C28H25Cl3FN3O and a molecular weight of 544.89 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-2-(1-propan-2-ylpiperidin-4-yl)-1,7-naphthyridin-7-ium.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-2-(1-propan-2-ylpiperidin-4-yl)-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24897234 |
| Molecular Formula | C28H25Cl3FN3O |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-8-(2,6-dichlorophenyl)-7-oxido-2-(1-propan-2-ylpiperidin-4-yl)-1,7-naphthyridin-7-ium |
| SMILES | CC(C)N1CCC(c2cc(-c3ccc(F)cc3Cl)c3cc[n+]([O-])c(-c4c(Cl)cccc4Cl)c3n2)CC1 |
| InChI | InChI=1S/C28H25Cl3FN3O/c1-16(2)34-11-8-17(9-12-34)25-15-21(19-7-6-18(32)14-24(19)31)20-10-13-35(36)28(27(20)33-25)26-22(29)4-3-5-23(26)30/h3-7,10,13-17H,8-9,11-12H2,1-2H3 |
| InChIKey | ODEMNMZLNPEBTF-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|