About (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol
(1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol (PubChem CID 24897482) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol.
Molecular Properties
| Compound Name | (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol |
| PubChem CID | 24897482 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol |
| SMILES | CNC[C@@H](O)[C@H](c1ccccc1)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H24N2O/c1-14-9-11-16(12-10-14)20(3)18(17(21)13-19-2)15-7-5-4-6-8-15/h4-12,17-19,21H,13H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | ONSNNWXLUHKPDE-MSOLQXFVSA-N |
| XLogP | 2.75 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol?
The IUPAC name of (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol (CID 24897482) is (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol.
What is the SMILES notation for (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol?
The canonical SMILES for (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol is CNC[C@@H](O)[C@H](c1ccccc1)N(C)c1ccc(C)cc1.
What is the InChIKey of (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol?
The InChIKey is ONSNNWXLUHKPDE-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H24N2O/c1-14-9-11-16(12-10-14)20(3)18(17(21)13-19-2)15-7-5-4-6-8-15/h4-12,17-19,21H,13H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol?
(1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol has a molecular weight of 284.40 g/mol, XLogP of 2.75, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-(N,4-dimethylanilino)-3-(methylamino)-1-phenylpropan-2-ol is sourced from PubChem (CID 24897482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).