C21H18F4N8 — CID 24897494
4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[(E)-(2,2,2-trifluoroethylhydrazinylidene)methyl]pyrimidine-4,6-diamine (PubChem CID 24897494) has the molecular formula C21H18F4N8 and a molecular weight of 458.42 g/mol. Its IUPAC name is 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[(E)-(2,2,2-trifluoroethylhydrazinylidene)methyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[(E)-(2,2,2-trifluoroethylhydrazinylidene)methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 24897494 |
| Molecular Formula | C21H18F4N8 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[(E)-(2,2,2-trifluoroethylhydrazinylidene)methyl]pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2ccc3c(cnn3Cc3cccc(F)c3)c2)c1/C=N/NCC(F)(F)F |
| InChI | InChI=1S/C21H18F4N8/c22-15-3-1-2-13(6-15)10-33-18-5-4-16(7-14(18)8-31-33)32-20-17(19(26)27-12-28-20)9-29-30-11-21(23,24)25/h1-9,12,30H,10-11H2,(H3,26,27,28,32)/b29-9+ |
| InChIKey | KVQIKILPEUOSQA-GESPGMLMSA-N |
| XLogP | 3.83 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|