C24H27N5O5 — CID 24897540
(2S,5S)-5-[3-(diaminomethylideneamino)propyl]-4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid (PubChem CID 24897540) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is (2S,5S)-5-[3-(diaminomethylideneamino)propyl]-4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid.
| Compound Name | (2S,5S)-5-[3-(diaminomethylideneamino)propyl]-4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 24897540 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (2S,5S)-5-[3-(diaminomethylideneamino)propyl]-4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid |
| SMILES | NC(N)=NCCC[C@H]1C(=O)N[C@H](C(=O)O)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27N5O5/c25-23(26)27-11-5-10-20-21(30)28-19(22(31)32)12-29(20)24(33)34-13-18-16-8-3-1-6-14(16)15-7-2-4-9-17(15)18/h1-4,6-9,18-20H,5,10-13H2,(H,28,30)(H,31,32)(H4,25,26,27)/t19-,20-/m0/s1 |
| InChIKey | VVMKXKBQSOIALS-PMACEKPBSA-N |
| XLogP | 1.24 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|