C21H25N5O — CID 24897730
2-[4-[(cyclohexylmethylamino)methyl]-2-pyridinyl]-4-pyridin-3-yl-1H-pyrazol-3-one (PubChem CID 24897730) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-[4-[(cyclohexylmethylamino)methyl]-2-pyridinyl]-4-pyridin-3-yl-1H-pyrazol-3-one.
| Compound Name | 2-[4-[(cyclohexylmethylamino)methyl]-2-pyridinyl]-4-pyridin-3-yl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 24897730 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-[4-[(cyclohexylmethylamino)methyl]-2-pyridinyl]-4-pyridin-3-yl-1H-pyrazol-3-one |
| SMILES | O=c1c(-c2cccnc2)c[nH]n1-c1cc(CNCC2CCCCC2)ccn1 |
| InChI | InChI=1S/C21H25N5O/c27-21-19(18-7-4-9-22-14-18)15-25-26(21)20-11-17(8-10-24-20)13-23-12-16-5-2-1-3-6-16/h4,7-11,14-16,23,25H,1-3,5-6,12-13H2 |
| InChIKey | SYHWSDCXCZFQKA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |