About 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol
4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol (PubChem CID 24897977) has the molecular formula C23H21N3OS
and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol.
Molecular Properties
| Compound Name | 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol |
| PubChem CID | 24897977 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol |
| SMILES | Cc1ccc(Sc2ccc(O)cc2)c(Nc2cc(C)nc3nc(C)ccc23)c1 |
| InChI | InChI=1S/C23H21N3OS/c1-14-4-11-22(28-18-8-6-17(27)7-9-18)21(12-14)26-20-13-16(3)25-23-19(20)10-5-15(2)24-23/h4-13,27H,1-3H3,(H,24,25,26) |
| InChIKey | SBHXLAAVPNXMRI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol?
The IUPAC name of 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol (CID 24897977) is 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol.
What is the SMILES notation for 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol?
The canonical SMILES for 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol is Cc1ccc(Sc2ccc(O)cc2)c(Nc2cc(C)nc3nc(C)ccc23)c1.
What is the InChIKey of 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol?
The InChIKey is SBHXLAAVPNXMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3OS/c1-14-4-11-22(28-18-8-6-17(27)7-9-18)21(12-14)26-20-13-16(3)25-23-19(20)10-5-15(2)24-23/h4-13,27H,1-3H3,(H,24,25,26).
What are the key properties of 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol?
4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol has a molecular weight of 387.51 g/mol, XLogP of 6.16, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2,7-dimethyl-1,8-naphthyridin-4-yl)amino]-4-methylphenyl]sulfanylphenol is sourced from PubChem (CID 24897977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).