C22H23NO5S — CID 24898161
(3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 24898161) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 24898161 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | OC[C@H]1SC2(OCc3ccc(Cc4cc5ccccc5[nH]4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H23NO5S/c24-10-18-19(25)20(26)21(27)22(29-18)16-8-12(5-6-14(16)11-28-22)7-15-9-13-3-1-2-4-17(13)23-15/h1-6,8-9,18-21,23-27H,7,10-11H2/t18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | ADQZSVRRWBFEOZ-VEIQOZLZSA-N |
| XLogP | 1.63 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |