C22H40O4Si — CID 24898210
[(E,3R,8R)-3,7,8-trimethyl-5-methylidene-10-oxo-8-triethylsilyloxydec-6-enyl] acetate (PubChem CID 24898210) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is [(E,3R,8R)-3,7,8-trimethyl-5-methylidene-10-oxo-8-triethylsilyloxydec-6-enyl] acetate.
| Compound Name | [(E,3R,8R)-3,7,8-trimethyl-5-methylidene-10-oxo-8-triethylsilyloxydec-6-enyl] acetate |
|---|---|
| PubChem CID | 24898210 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [(E,3R,8R)-3,7,8-trimethyl-5-methylidene-10-oxo-8-triethylsilyloxydec-6-enyl] acetate |
| SMILES | C=C(/C=C(\C)[C@@](C)(CC=O)O[Si](CC)(CC)CC)C[C@@H](C)CCOC(C)=O |
| InChI | InChI=1S/C22H40O4Si/c1-9-27(10-2,11-3)26-22(8,13-14-23)20(6)17-19(5)16-18(4)12-15-25-21(7)24/h14,17-18H,5,9-13,15-16H2,1-4,6-8H3/b20-17+/t18-,22+/m0/s1 |
| InChIKey | XCOPGPQGPPWTSE-WADGHTFFSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|