About carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate
carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate (PubChem CID 24898214) has the molecular formula C22H18Co2O9
and a molecular weight of 544.24 g/mol. Its IUPAC name is carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate.
Molecular Properties
| Compound Name | carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate |
| PubChem CID | 24898214 |
| Molecular Formula | C22H18Co2O9 |
| Molecular Weight | 544.24 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate |
| SMILES | C#Cc1ccc(OC)cc1CCC(=C)COC(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C16H18O3.6CO.2Co/c1-5-14-8-9-16(18-4)10-15(14)7-6-12(2)11-19-13(3)17;6*1-2;;/h1,8-10H,2,6-7,11H2,3-4H3;;;;;;;; |
| InChIKey | QICMIRMKBQOPTE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 154.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate?
The IUPAC name of carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate (CID 24898214) is carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate.
What is the SMILES notation for carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate?
The canonical SMILES for carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate is C#Cc1ccc(OC)cc1CCC(=C)COC(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co].
What is the InChIKey of carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate?
The InChIKey is QICMIRMKBQOPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O3.6CO.2Co/c1-5-14-8-9-16(18-4)10-15(14)7-6-12(2)11-19-13(3)17;6*1-2;;/h1,8-10H,2,6-7,11H2,3-4H3;;;;;;;;.
What are the key properties of carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate?
carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate has a molecular weight of 544.24 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;[4-(2-ethynyl-5-methoxyphenyl)-2-methylidenebutyl] acetate is sourced from PubChem (CID 24898214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).