C25H28O6S — CID 24898377
(3'R,4'S,5'S,6'R)-8-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,2'-thiane]-3',4',5'-triol (PubChem CID 24898377) has the molecular formula C25H28O6S and a molecular weight of 456.56 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R)-8-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,2'-thiane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R)-8-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 24898377 |
| Molecular Formula | C25H28O6S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (3'R,4'S,5'S,6'R)-8-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,2'-thiane]-3',4',5'-triol |
| SMILES | CCc1ccc(Cc2cccc3c4c(oc23)C2(OCC4)S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H28O6S/c1-2-14-6-8-15(9-7-14)12-16-4-3-5-17-18-10-11-30-25(24(18)31-22(16)17)23(29)21(28)20(27)19(13-26)32-25/h3-9,19-21,23,26-29H,2,10-13H2,1H3/t19-,20-,21+,23-,25?/m1/s1 |
| InChIKey | XNISCLNPIKYOEK-WUPLIVIJSA-N |
| XLogP | 2.50 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |