About 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine (PubChem CID 24898530) has the molecular formula C24H19ClF2N4
and a molecular weight of 436.89 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine |
| PubChem CID | 24898530 |
| Molecular Formula | C24H19ClF2N4 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine |
| SMILES | Fc1ccc(-c2cc(N3CCNCC3)nc3c(-c4ccccc4Cl)nccc23)c(F)c1 |
| InChI | InChI=1S/C24H19ClF2N4/c25-20-4-2-1-3-18(20)23-24-17(7-8-29-23)19(16-6-5-15(26)13-21(16)27)14-22(30-24)31-11-9-28-10-12-31/h1-8,13-14,28H,9-12H2 |
| InChIKey | BPIROPIUWUYRIC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The IUPAC name of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine (CID 24898530) is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine.
What is the SMILES notation for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The canonical SMILES for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine is Fc1ccc(-c2cc(N3CCNCC3)nc3c(-c4ccccc4Cl)nccc23)c(F)c1.
What is the InChIKey of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The InChIKey is BPIROPIUWUYRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19ClF2N4/c25-20-4-2-1-3-18(20)23-24-17(7-8-29-23)19(16-6-5-15(26)13-21(16)27)14-22(30-24)31-11-9-28-10-12-31/h1-8,13-14,28H,9-12H2.
What are the key properties of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine?
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine has a molecular weight of 436.89 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-2-piperazin-1-yl-1,7-naphthyridine is sourced from PubChem (CID 24898530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).