C25H20Cl2F2N4O — CID 24898531
8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine (PubChem CID 24898531) has the molecular formula C25H20Cl2F2N4O and a molecular weight of 501.36 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine.
| Compound Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
|---|---|
| PubChem CID | 24898531 |
| Molecular Formula | C25H20Cl2F2N4O |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)cc(NC3CCNCC3)nc2c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H20Cl2F2N4O/c26-19-2-1-3-20(27)23(19)25-24-17(8-11-33(25)34)18(16-5-4-14(28)12-21(16)29)13-22(32-24)31-15-6-9-30-10-7-15/h1-5,8,11-13,15,30H,6-7,9-10H2,(H,31,32) |
| InChIKey | NGGUIYJLUVYUKE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|