About 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine
4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine (PubChem CID 24898532) has the molecular formula C25H22F2N4
and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine.
Molecular Properties
| Compound Name | 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine |
| PubChem CID | 24898532 |
| Molecular Formula | C25H22F2N4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine |
| SMILES | Cc1ccccc1-c1nccc2c(-c3ccc(F)cc3F)cc(N3CCNCC3)nc12 |
| InChI | InChI=1S/C25H22F2N4/c1-16-4-2-3-5-18(16)24-25-20(8-9-29-24)21(19-7-6-17(26)14-22(19)27)15-23(30-25)31-12-10-28-11-13-31/h2-9,14-15,28H,10-13H2,1H3 |
| InChIKey | QJXSOBZZFCPIBR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The IUPAC name of 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine (CID 24898532) is 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine.
What is the SMILES notation for 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The canonical SMILES for 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine is Cc1ccccc1-c1nccc2c(-c3ccc(F)cc3F)cc(N3CCNCC3)nc12.
What is the InChIKey of 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine?
The InChIKey is QJXSOBZZFCPIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22F2N4/c1-16-4-2-3-5-18(16)24-25-20(8-9-29-24)21(19-7-6-17(26)14-22(19)27)15-23(30-25)31-12-10-28-11-13-31/h2-9,14-15,28H,10-13H2,1H3.
What are the key properties of 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine?
4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine has a molecular weight of 416.48 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-2-piperazin-1-yl-1,7-naphthyridine is sourced from PubChem (CID 24898532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).