C25H21ClF2N4O — CID 24898749
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine (PubChem CID 24898749) has the molecular formula C25H21ClF2N4O and a molecular weight of 466.92 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine.
| Compound Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
|---|---|
| PubChem CID | 24898749 |
| Molecular Formula | C25H21ClF2N4O |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)cc(NC3CCNCC3)nc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C25H21ClF2N4O/c26-21-4-2-1-3-19(21)25-24-18(9-12-32(25)33)20(17-6-5-15(27)13-22(17)28)14-23(31-24)30-16-7-10-29-11-8-16/h1-6,9,12-14,16,29H,7-8,10-11H2,(H,30,31) |
| InChIKey | JHXADCQQTHHUPC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|