C26H24F2N4O — CID 24898750
4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine (PubChem CID 24898750) has the molecular formula C26H24F2N4O and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine.
| Compound Name | 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
|---|---|
| PubChem CID | 24898750 |
| Molecular Formula | C26H24F2N4O |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-N-piperidin-4-yl-1,7-naphthyridin-7-ium-2-amine |
| SMILES | Cc1ccccc1-c1c2nc(NC3CCNCC3)cc(-c3ccc(F)cc3F)c2cc[n+]1[O-] |
| InChI | InChI=1S/C26H24F2N4O/c1-16-4-2-3-5-19(16)26-25-21(10-13-32(26)33)22(20-7-6-17(27)14-23(20)28)15-24(31-25)30-18-8-11-29-12-9-18/h2-7,10,13-15,18,29H,8-9,11-12H2,1H3,(H,30,31) |
| InChIKey | LDPNBRPWXRNCOE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|