C26H42N5NaO9S2 — CID 24899065
sodium 1-[6-[6-[5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 24899065) has the molecular formula C26H42N5NaO9S2 and a molecular weight of 655.77 g/mol. Its IUPAC name is sodium 1-[6-[6-[5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | sodium 1-[6-[6-[5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 24899065 |
| Molecular Formula | C26H42N5NaO9S2 |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | sodium 1-[6-[6-[5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SCC2NCNC21)NCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C26H43N5O9S2.Na/c32-21(27-14-8-2-4-12-24(35)40-31-23(34)15-20(26(31)36)42(37,38)39)10-3-1-7-13-28-22(33)11-6-5-9-19-25-18(16-41-19)29-17-30-25;/h18-20,25,29-30H,1-17H2,(H,27,32)(H,28,33)(H,37,38,39);/q;+1/p-1 |
| InChIKey | LEEZARKGANLNEL-UHFFFAOYSA-M |
| XLogP | -2.96 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|