C28H38N2O2S — CID 24899110
1-(4-methylphenyl)sulfonyl-2-(1-piperidin-1-yloctyl)indole (PubChem CID 24899110) has the molecular formula C28H38N2O2S and a molecular weight of 466.69 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-(1-piperidin-1-yloctyl)indole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-(1-piperidin-1-yloctyl)indole |
|---|---|
| PubChem CID | 24899110 |
| Molecular Formula | C28H38N2O2S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-(1-piperidin-1-yloctyl)indole |
| SMILES | CCCCCCCC(c1cc2ccccc2n1S(=O)(=O)c1ccc(C)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H38N2O2S/c1-3-4-5-6-8-15-27(29-20-11-7-12-21-29)28-22-24-13-9-10-14-26(24)30(28)33(31,32)25-18-16-23(2)17-19-25/h9-10,13-14,16-19,22,27H,3-8,11-12,15,20-21H2,1-2H3 |
| InChIKey | QIUADOKBZANHBI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|