C18H14N4O4S2 — CID 24899174
ethyl 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxylate (PubChem CID 24899174) has the molecular formula C18H14N4O4S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 24899174 |
| Molecular Formula | C18H14N4O4S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | ethyl 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1csc2nc(-c3cccs3)nc(NN3C(=O)C=C(C)C3=O)c12 |
| InChI | InChI=1S/C18H14N4O4S2/c1-3-26-18(25)10-8-28-16-13(10)15(19-14(20-16)11-5-4-6-27-11)21-22-12(23)7-9(2)17(22)24/h4-8H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | XYYHXMBTJCGTHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|