C15H25BrO2 — CID 24899361
(2R,3R)-3-[(E)-5-bromo-3-methylpent-3-enyl]-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyloxirane (PubChem CID 24899361) has the molecular formula C15H25BrO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is (2R,3R)-3-[(E)-5-bromo-3-methylpent-3-enyl]-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyloxirane.
| Compound Name | (2R,3R)-3-[(E)-5-bromo-3-methylpent-3-enyl]-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyloxirane |
|---|---|
| PubChem CID | 24899361 |
| Molecular Formula | C15H25BrO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2R,3R)-3-[(E)-5-bromo-3-methylpent-3-enyl]-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyloxirane |
| SMILES | C/C(=C\CBr)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C15H25BrO2/c1-11(8-10-16)5-6-13-15(4,18-13)9-7-12-14(2,3)17-12/h8,12-13H,5-7,9-10H2,1-4H3/b11-8+/t12-,13-,15-/m1/s1 |
| InChIKey | VYBWDKLFZSECCY-VFBYWLOFSA-N |
| XLogP | 4.22 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|