About (2Z)-N,N,2-trimethylpenta-2,4-dienamide
(2Z)-N,N,2-trimethylpenta-2,4-dienamide (PubChem CID 24899374) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (2Z)-N,N,2-trimethylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2Z)-N,N,2-trimethylpenta-2,4-dienamide |
| PubChem CID | 24899374 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2Z)-N,N,2-trimethylpenta-2,4-dienamide |
| SMILES | C=C/C=C(/C)C(=O)N(C)C |
| InChI | InChI=1S/C8H13NO/c1-5-6-7(2)8(10)9(3)4/h5-6H,1H2,2-4H3/b7-6- |
| InChIKey | FSIGWMUFABXIOI-SREVYHEPSA-N |
| XLogP | 1.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,N,2-trimethylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,N,2-trimethylpenta-2,4-dienamide?
The IUPAC name of (2Z)-N,N,2-trimethylpenta-2,4-dienamide (CID 24899374) is (2Z)-N,N,2-trimethylpenta-2,4-dienamide.
What is the SMILES notation for (2Z)-N,N,2-trimethylpenta-2,4-dienamide?
The canonical SMILES for (2Z)-N,N,2-trimethylpenta-2,4-dienamide is C=C/C=C(/C)C(=O)N(C)C.
What is the InChIKey of (2Z)-N,N,2-trimethylpenta-2,4-dienamide?
The InChIKey is FSIGWMUFABXIOI-SREVYHEPSA-N. The full InChI is InChI=1S/C8H13NO/c1-5-6-7(2)8(10)9(3)4/h5-6H,1H2,2-4H3/b7-6-.
What are the key properties of (2Z)-N,N,2-trimethylpenta-2,4-dienamide?
(2Z)-N,N,2-trimethylpenta-2,4-dienamide has a molecular weight of 139.20 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,N,2-trimethylpenta-2,4-dienamide is sourced from PubChem (CID 24899374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).