C20H32O3 — CID 24899405
(1S,4E,9S,12E,14S)-12-(2-hydroxypropan-2-yl)-1,5,9-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,12-dien-7-one (PubChem CID 24899405) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,4E,9S,12E,14S)-12-(2-hydroxypropan-2-yl)-1,5,9-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,12-dien-7-one.
| Compound Name | (1S,4E,9S,12E,14S)-12-(2-hydroxypropan-2-yl)-1,5,9-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,12-dien-7-one |
|---|---|
| PubChem CID | 24899405 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,4E,9S,12E,14S)-12-(2-hydroxypropan-2-yl)-1,5,9-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,12-dien-7-one |
| SMILES | C/C1=C\CC[C@]2(C)O[C@H]2/C=C(/C(C)(C)O)CC[C@H](C)CC(=O)C1 |
| InChI | InChI=1S/C20H32O3/c1-14-7-6-10-20(5)18(23-20)13-16(19(3,4)22)9-8-15(2)12-17(21)11-14/h7,13,15,18,22H,6,8-12H2,1-5H3/b14-7+,16-13+/t15-,18-,20-/m0/s1 |
| InChIKey | IRGVGKNVASOSJW-FCECOGMUSA-N |
| XLogP | 4.35 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|