C16H12N4O3S2 — CID 24899434
1-[[5-(hydroxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione (PubChem CID 24899434) has the molecular formula C16H12N4O3S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[[5-(hydroxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[[5-(hydroxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 24899434 |
| Molecular Formula | C16H12N4O3S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-[[5-(hydroxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(Nc2nc(-c3cccs3)nc3scc(CO)c23)C1=O |
| InChI | InChI=1S/C16H12N4O3S2/c1-8-5-11(22)20(16(8)23)19-14-12-9(6-21)7-25-15(12)18-13(17-14)10-3-2-4-24-10/h2-5,7,21H,6H2,1H3,(H,17,18,19) |
| InChIKey | AQGDDFNDMXLDGP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|