C31H46N7O10P — CID 24899452
propan-2-yl 2-[[[3-[[6-amino-8-ethoxycarbonyloxy-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]methyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate (PubChem CID 24899452) has the molecular formula C31H46N7O10P and a molecular weight of 707.72 g/mol. Its IUPAC name is propan-2-yl 2-[[[3-[[6-amino-8-ethoxycarbonyloxy-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]methyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[3-[[6-amino-8-ethoxycarbonyloxy-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]methyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 24899452 |
| Molecular Formula | C31H46N7O10P |
| Molecular Weight | 707.72 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | propan-2-yl 2-[[[3-[[6-amino-8-ethoxycarbonyloxy-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]methyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)Oc1nc2c(N)nc(OCCOC)nc2n1Cc1cccc(CP(=O)(NC(C)C(=O)OC(C)C)NC(C)C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C31H46N7O10P/c1-9-44-31(41)48-30-33-24-25(32)34-29(45-14-13-43-8)35-26(24)38(30)16-22-11-10-12-23(15-22)17-49(42,36-20(6)27(39)46-18(2)3)37-21(7)28(40)47-19(4)5/h10-12,15,18-21H,9,13-14,16-17H2,1-8H3,(H2,32,34,35)(H2,36,37,42) |
| InChIKey | FXPFDUTUOWIOEV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 217.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|