C8H11F6N3O4S2 — CID 24899624
bis(trifluoromethylsulfonyl)azanide;1-(1,1,2,2,2-pentadeuterioethyl)-3-(trideuteriomethyl)imidazol-3-ium (PubChem CID 24899624) has the molecular formula C8H11F6N3O4S2 and a molecular weight of 399.36 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-(1,1,2,2,2-pentadeuterioethyl)-3-(trideuteriomethyl)imidazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-(1,1,2,2,2-pentadeuterioethyl)-3-(trideuteriomethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 24899624 |
| Molecular Formula | C8H11F6N3O4S2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-(1,1,2,2,2-pentadeuterioethyl)-3-(trideuteriomethyl)imidazol-3-ium |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[2H]C([2H])([2H])[n+]1ccn(C([2H])([2H])C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C6H11N2.C2F6NO4S2/c1-3-8-5-4-7(2)6-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H,3H2,1-2H3;/q+1;-1/i1D3,2D3,3D2; |
| InChIKey | LRESCJAINPKJTO-FIRJCWQZSA-N |
| XLogP | 1.39 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|