C17H14N4O3S2 — CID 24899682
1-[[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione (PubChem CID 24899682) has the molecular formula C17H14N4O3S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 24899682 |
| Molecular Formula | C17H14N4O3S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-[[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
| SMILES | COCc1csc2nc(-c3cccs3)nc(NN3C(=O)C=C(C)C3=O)c12 |
| InChI | InChI=1S/C17H14N4O3S2/c1-9-6-12(22)21(17(9)23)20-15-13-10(7-24-2)8-26-16(13)19-14(18-15)11-4-3-5-25-11/h3-6,8H,7H2,1-2H3,(H,18,19,20) |
| InChIKey | RSJSVEOQJLMHBO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|