C24H21ClFN5O3S — CID 24899869
[3-[6-amino-8-[3-(5-chloro-2-fluoro-3-pyridinyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate (PubChem CID 24899869) has the molecular formula C24H21ClFN5O3S and a molecular weight of 513.98 g/mol. Its IUPAC name is [3-[6-amino-8-[3-(5-chloro-2-fluoro-3-pyridinyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate.
| Compound Name | [3-[6-amino-8-[3-(5-chloro-2-fluoro-3-pyridinyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 24899869 |
| Molecular Formula | C24H21ClFN5O3S |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | [3-[6-amino-8-[3-(5-chloro-2-fluoro-3-pyridinyl)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(C2(c3cccc(-c4cc(Cl)cnc4F)c3)N=C(N)N3CCCN=C32)c1 |
| InChI | InChI=1S/C24H21ClFN5O3S/c1-35(32,33)34-19-8-3-7-17(12-19)24(22-28-9-4-10-31(22)23(27)30-24)16-6-2-5-15(11-16)20-13-18(25)14-29-21(20)26/h2-3,5-8,11-14H,4,9-10H2,1H3,(H2,27,30) |
| InChIKey | NGHJFICTEJYDTQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|